C19H23F3N2O2 — CID 134509420
1,1,1-trifluoropropan-2-yl 4-[(4-methyl-2-prop-1-ynylphenyl)methyl]piperazine-1-carboxylate (PubChem CID 134509420) has the molecular formula C19H23F3N2O2 and a molecular weight of 368.40 g/mol. Its IUPAC name is 1,1,1-trifluoropropan-2-yl 4-[(4-methyl-2-prop-1-ynylphenyl)methyl]piperazine-1-carboxylate.
| Compound Name | 1,1,1-trifluoropropan-2-yl 4-[(4-methyl-2-prop-1-ynylphenyl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 134509420 |
| Molecular Formula | C19H23F3N2O2 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 1,1,1-trifluoropropan-2-yl 4-[(4-methyl-2-prop-1-ynylphenyl)methyl]piperazine-1-carboxylate |
| SMILES | CC#Cc1cc(C)ccc1CN1CCN(C(=O)OC(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C19H23F3N2O2/c1-4-5-16-12-14(2)6-7-17(16)13-23-8-10-24(11-9-23)18(25)26-15(3)19(20,21)22/h6-7,12,15H,8-11,13H2,1-3H3 |
| InChIKey | ZONYCYUXKMNIJY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|