C19H23ClF6N2O5 — CID 134514876
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[4-chloro-2-(4,4-dihydroxybutoxy)phenyl]methyl]piperazine-1-carboxylate (PubChem CID 134514876) has the molecular formula C19H23ClF6N2O5 and a molecular weight of 508.84 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[4-chloro-2-(4,4-dihydroxybutoxy)phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[4-chloro-2-(4,4-dihydroxybutoxy)phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 134514876 |
| Molecular Formula | C19H23ClF6N2O5 |
| Molecular Weight | 508.84 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[4-chloro-2-(4,4-dihydroxybutoxy)phenyl]methyl]piperazine-1-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCN(Cc2ccc(Cl)cc2OCCCC(O)O)CC1 |
| InChI | InChI=1S/C19H23ClF6N2O5/c20-13-4-3-12(14(10-13)32-9-1-2-15(29)30)11-27-5-7-28(8-6-27)17(31)33-16(18(21,22)23)19(24,25)26/h3-4,10,15-16,29-30H,1-2,5-9,11H2 |
| InChIKey | SLEKGUSSLDRRPE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 82.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.84 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|