C21H23ClF6N2O4 — CID 160735510
carbon dioxide;1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(4-chloro-2-cyclopentylphenyl)methyl]piperazine-1-carboxylate (PubChem CID 160735510) has the molecular formula C21H23ClF6N2O4 and a molecular weight of 516.87 g/mol. Its IUPAC name is carbon dioxide;1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(4-chloro-2-cyclopentylphenyl)methyl]piperazine-1-carboxylate.
| Compound Name | carbon dioxide;1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(4-chloro-2-cyclopentylphenyl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 160735510 |
| Molecular Formula | C21H23ClF6N2O4 |
| Molecular Weight | 516.87 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | carbon dioxide;1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(4-chloro-2-cyclopentylphenyl)methyl]piperazine-1-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCN(Cc2ccc(Cl)cc2C2CCCC2)CC1.O=C=O |
| InChI | InChI=1S/C20H23ClF6N2O2.CO2/c21-15-6-5-14(16(11-15)13-3-1-2-4-13)12-28-7-9-29(10-8-28)18(30)31-17(19(22,23)24)20(25,26)27;2-1-3/h5-6,11,13,17H,1-4,7-10,12H2; |
| InChIKey | RUWWARYYVQNXCP-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.87 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |