C19H22F9N3O4 — CID 167004507
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-[[(2S)-1,1-dihydroxypropan-2-yl]amino]-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate (PubChem CID 167004507) has the molecular formula C19H22F9N3O4 and a molecular weight of 527.38 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-[[(2S)-1,1-dihydroxypropan-2-yl]amino]-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-[[(2S)-1,1-dihydroxypropan-2-yl]amino]-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 167004507 |
| Molecular Formula | C19H22F9N3O4 |
| Molecular Weight | 527.38 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-[[(2S)-1,1-dihydroxypropan-2-yl]amino]-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
| SMILES | C[C@H](Nc1cc(C(F)(F)F)ccc1CN1CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1)C(O)O |
| InChI | InChI=1S/C19H22F9N3O4/c1-10(14(32)33)29-13-8-12(17(20,21)22)3-2-11(13)9-30-4-6-31(7-5-30)16(34)35-15(18(23,24)25)19(26,27)28/h2-3,8,10,14-15,29,32-33H,4-7,9H2,1H3/t10-/m0/s1 |
| InChIKey | JEWZYYNZLFEDGA-JTQLQIEISA-N |
| XLogP | 3.56 |
| TPSA | 85.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|