C26H31F9N2O8 — CID 146257879
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-[2-methyl-1-oxo-1-(1-propan-2-yloxycarbonyloxyethoxy)propan-2-yl]oxy-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate (PubChem CID 146257879) has the molecular formula C26H31F9N2O8 and a molecular weight of 670.52 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-[2-methyl-1-oxo-1-(1-propan-2-yloxycarbonyloxyethoxy)propan-2-yl]oxy-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-[2-methyl-1-oxo-1-(1-propan-2-yloxycarbonyloxyethoxy)propan-2-yl]oxy-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 146257879 |
| Molecular Formula | C26H31F9N2O8 |
| Molecular Weight | 670.52 g/mol |
| Exact Mass | 670.19 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-[2-methyl-1-oxo-1-(1-propan-2-yloxycarbonyloxyethoxy)propan-2-yl]oxy-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)OC(=O)OC(C)OC(=O)C(C)(C)Oc1cc(C(F)(F)F)ccc1CN1CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C26H31F9N2O8/c1-14(2)41-22(40)43-15(3)42-20(38)23(4,5)45-18-12-17(24(27,28)29)7-6-16(18)13-36-8-10-37(11-9-36)21(39)44-19(25(30,31)32)26(33,34)35/h6-7,12,14-15,19H,8-11,13H2,1-5H3 |
| InChIKey | LBZJTMHWFOLTSM-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 103.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.52 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|