C26H33F9N2O7 — CID 156577150
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-[1-hydroxy-2-methyl-1-[1-(2-methylpropanoyloxy)ethoxy]propan-2-yl]oxy-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate (PubChem CID 156577150) has the molecular formula C26H33F9N2O7 and a molecular weight of 656.54 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-[1-hydroxy-2-methyl-1-[1-(2-methylpropanoyloxy)ethoxy]propan-2-yl]oxy-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-[1-hydroxy-2-methyl-1-[1-(2-methylpropanoyloxy)ethoxy]propan-2-yl]oxy-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 156577150 |
| Molecular Formula | C26H33F9N2O7 |
| Molecular Weight | 656.54 g/mol |
| Exact Mass | 656.21 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-[1-hydroxy-2-methyl-1-[1-(2-methylpropanoyloxy)ethoxy]propan-2-yl]oxy-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
| SMILES | CC(OC(=O)C(C)C)OC(O)C(C)(C)Oc1cc(C(F)(F)F)ccc1CN1CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C26H33F9N2O7/c1-14(2)19(38)41-15(3)42-21(39)23(4,5)44-18-12-17(24(27,28)29)7-6-16(18)13-36-8-10-37(11-9-36)22(40)43-20(25(30,31)32)26(33,34)35/h6-7,12,14-15,20-21,39H,8-11,13H2,1-5H3 |
| InChIKey | PNJRQGOWRUJBNJ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.54 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|