C23H28F9N3O6S — CID 156577242
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-[1-(cyclopropylsulfonylamino)-1-hydroxy-2-methylpropan-2-yl]oxy-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate (PubChem CID 156577242) has the molecular formula C23H28F9N3O6S and a molecular weight of 645.54 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-[1-(cyclopropylsulfonylamino)-1-hydroxy-2-methylpropan-2-yl]oxy-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-[1-(cyclopropylsulfonylamino)-1-hydroxy-2-methylpropan-2-yl]oxy-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 156577242 |
| Molecular Formula | C23H28F9N3O6S |
| Molecular Weight | 645.54 g/mol |
| Exact Mass | 645.16 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-[1-(cyclopropylsulfonylamino)-1-hydroxy-2-methylpropan-2-yl]oxy-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(Oc1cc(C(F)(F)F)ccc1CN1CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1)C(O)NS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C23H28F9N3O6S/c1-20(2,18(36)33-42(38,39)15-5-6-15)41-16-11-14(21(24,25)26)4-3-13(16)12-34-7-9-35(10-8-34)19(37)40-17(22(27,28)29)23(30,31)32/h3-4,11,15,17-18,33,36H,5-10,12H2,1-2H3 |
| InChIKey | ARRNNJHAPDZVPH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|