C21H22F9N3O4 — CID 134349113
(2S)-4-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-(trifluoromethyl)phenyl]pyrrolidine-2-carboxylic acid (PubChem CID 134349113) has the molecular formula C21H22F9N3O4 and a molecular weight of 551.41 g/mol. Its IUPAC name is (2S)-4-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-(trifluoromethyl)phenyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-4-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-(trifluoromethyl)phenyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 134349113 |
| Molecular Formula | C21H22F9N3O4 |
| Molecular Weight | 551.41 g/mol |
| Exact Mass | 551.15 |
| IUPAC Name | (2S)-4-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-(trifluoromethyl)phenyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CC(c2cc(C(F)(F)F)ccc2CN2CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC2)CN1 |
| InChI | InChI=1S/C21H22F9N3O4/c22-19(23,24)13-2-1-11(14(8-13)12-7-15(16(34)35)31-9-12)10-32-3-5-33(6-4-32)18(36)37-17(20(25,26)27)21(28,29)30/h1-2,8,12,15,17,31H,3-7,9-10H2,(H,34,35)/t12?,15-/m0/s1 |
| InChIKey | KHWRNQDAIBCYJP-CVRLYYSRSA-N |
| XLogP | 3.98 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |