C26H31F9N4O4 — CID 138706628
(2S)-1-[1-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-(trifluoromethyl)phenyl]piperidin-4-yl]pyrrolidine-2-carboxylic acid (PubChem CID 138706628) has the molecular formula C26H31F9N4O4 and a molecular weight of 634.54 g/mol. Its IUPAC name is (2S)-1-[1-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-(trifluoromethyl)phenyl]piperidin-4-yl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[1-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-(trifluoromethyl)phenyl]piperidin-4-yl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 138706628 |
| Molecular Formula | C26H31F9N4O4 |
| Molecular Weight | 634.54 g/mol |
| Exact Mass | 634.22 |
| IUPAC Name | (2S)-1-[1-[2-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)piperazin-1-yl]methyl]-5-(trifluoromethyl)phenyl]piperidin-4-yl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1C1CCN(c2cc(C(F)(F)F)ccc2CN2CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C26H31F9N4O4/c27-24(28,29)17-4-3-16(20(14-17)37-8-5-18(6-9-37)39-7-1-2-19(39)21(40)41)15-36-10-12-38(13-11-36)23(42)43-22(25(30,31)32)26(33,34)35/h3-4,14,18-19,22H,1-2,5-13,15H2,(H,40,41)/t19-/m0/s1 |
| InChIKey | LSEPMHRQEXHEHU-IBGZPJMESA-N |
| XLogP | 4.97 |
| TPSA | 76.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.54 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |