C26H32F9N3O2 — CID 155921902
1,1,1,3,3,3-hexafluoropropan-2-yl 2-[[2-(3-methylpiperidin-1-yl)-4-(trifluoromethyl)phenyl]methyl]-2,8-diazaspiro[4.5]decane-8-carboxylate (PubChem CID 155921902) has the molecular formula C26H32F9N3O2 and a molecular weight of 589.54 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[[2-(3-methylpiperidin-1-yl)-4-(trifluoromethyl)phenyl]methyl]-2,8-diazaspiro[4.5]decane-8-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[[2-(3-methylpiperidin-1-yl)-4-(trifluoromethyl)phenyl]methyl]-2,8-diazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 155921902 |
| Molecular Formula | C26H32F9N3O2 |
| Molecular Weight | 589.54 g/mol |
| Exact Mass | 589.24 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[[2-(3-methylpiperidin-1-yl)-4-(trifluoromethyl)phenyl]methyl]-2,8-diazaspiro[4.5]decane-8-carboxylate |
| SMILES | CC1CCCN(c2cc(C(F)(F)F)ccc2CN2CCC3(CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC3)C2)C1 |
| InChI | InChI=1S/C26H32F9N3O2/c1-17-3-2-9-38(14-17)20-13-19(24(27,28)29)5-4-18(20)15-36-10-6-23(16-36)7-11-37(12-8-23)22(39)40-21(25(30,31)32)26(33,34)35/h4-5,13,17,21H,2-3,6-12,14-16H2,1H3 |
| InChIKey | QUVCOLJQOQQFBQ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.54 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |