C26H32F9N3O2 — CID 145401338
1-[2-[[8-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2,8-diazaspiro[4.5]decan-2-yl]methyl]-5-(trifluoromethyl)phenyl]-3-methylpiperidine-3-carboxylic acid (PubChem CID 145401338) has the molecular formula C26H32F9N3O2 and a molecular weight of 589.54 g/mol. Its IUPAC name is 1-[2-[[8-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2,8-diazaspiro[4.5]decan-2-yl]methyl]-5-(trifluoromethyl)phenyl]-3-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[2-[[8-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2,8-diazaspiro[4.5]decan-2-yl]methyl]-5-(trifluoromethyl)phenyl]-3-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 145401338 |
| Molecular Formula | C26H32F9N3O2 |
| Molecular Weight | 589.54 g/mol |
| Exact Mass | 589.24 |
| IUPAC Name | 1-[2-[[8-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2,8-diazaspiro[4.5]decan-2-yl]methyl]-5-(trifluoromethyl)phenyl]-3-methylpiperidine-3-carboxylic acid |
| SMILES | CC1(C(=O)O)CCCN(c2cc(C(F)(F)F)ccc2CN2CCC3(CCN(C(C(F)(F)F)C(F)(F)F)CC3)C2)C1 |
| InChI | InChI=1S/C26H32F9N3O2/c1-22(21(39)40)5-2-9-38(15-22)19-13-18(24(27,28)29)4-3-17(19)14-36-10-6-23(16-36)7-11-37(12-8-23)20(25(30,31)32)26(33,34)35/h3-4,13,20H,2,5-12,14-16H2,1H3,(H,39,40) |
| InChIKey | XIMAHHUPFBBUKB-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.54 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |