C20H24Cl2F9N3O2 — CID 175732865
2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-[[2-pyrrolidin-1-yl-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylic acid;dihydrochloride (PubChem CID 175732865) has the molecular formula C20H24Cl2F9N3O2 and a molecular weight of 580.32 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-[[2-pyrrolidin-1-yl-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylic acid;dihydrochloride.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-[[2-pyrrolidin-1-yl-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylic acid;dihydrochloride |
|---|---|
| PubChem CID | 175732865 |
| Molecular Formula | C20H24Cl2F9N3O2 |
| Molecular Weight | 580.32 g/mol |
| Exact Mass | 579.11 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-[[2-pyrrolidin-1-yl-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylic acid;dihydrochloride |
| SMILES | Cl.Cl.O=C(O)N1CCN(Cc2ccc(C(F)(F)F)cc2N2CCCC2)CC1C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H22F9N3O2.2ClH/c21-18(22,23)13-4-3-12(14(9-13)31-5-1-2-6-31)10-30-7-8-32(17(33)34)15(11-30)16(19(24,25)26)20(27,28)29;;/h3-4,9,15-16H,1-2,5-8,10-11H2,(H,33,34);2*1H |
| InChIKey | PHMWRDQZEBFVFM-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.32 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |