C21H20F7N3O2 — CID 134536900
4-[[6-(3-fluorophenyl)-2-methyl-3-pyridinyl]methyl]-2-(1,1,1,3,3,3-hexafluoropropan-2-yl)piperazine-1-carboxylic acid (PubChem CID 134536900) has the molecular formula C21H20F7N3O2 and a molecular weight of 479.40 g/mol. Its IUPAC name is 4-[[6-(3-fluorophenyl)-2-methyl-3-pyridinyl]methyl]-2-(1,1,1,3,3,3-hexafluoropropan-2-yl)piperazine-1-carboxylic acid.
| Compound Name | 4-[[6-(3-fluorophenyl)-2-methyl-3-pyridinyl]methyl]-2-(1,1,1,3,3,3-hexafluoropropan-2-yl)piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 134536900 |
| Molecular Formula | C21H20F7N3O2 |
| Molecular Weight | 479.40 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 4-[[6-(3-fluorophenyl)-2-methyl-3-pyridinyl]methyl]-2-(1,1,1,3,3,3-hexafluoropropan-2-yl)piperazine-1-carboxylic acid |
| SMILES | Cc1nc(-c2cccc(F)c2)ccc1CN1CCN(C(=O)O)C(C(C(F)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C21H20F7N3O2/c1-12-14(5-6-16(29-12)13-3-2-4-15(22)9-13)10-30-7-8-31(19(32)33)17(11-30)18(20(23,24)25)21(26,27)28/h2-6,9,17-18H,7-8,10-11H2,1H3,(H,32,33) |
| InChIKey | HGWCDVYALXSART-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.40 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |