C17H22F3IN2O2 — CID 172812968
2-tert-butyl-4-[[2-iodo-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylic acid (PubChem CID 172812968) has the molecular formula C17H22F3IN2O2 and a molecular weight of 470.27 g/mol. Its IUPAC name is 2-tert-butyl-4-[[2-iodo-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylic acid.
| Compound Name | 2-tert-butyl-4-[[2-iodo-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 172812968 |
| Molecular Formula | C17H22F3IN2O2 |
| Molecular Weight | 470.27 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | 2-tert-butyl-4-[[2-iodo-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylic acid |
| SMILES | CC(C)(C)C1CN(Cc2ccc(C(F)(F)F)cc2I)CCN1C(=O)O |
| InChI | InChI=1S/C17H22F3IN2O2/c1-16(2,3)14-10-22(6-7-23(14)15(24)25)9-11-4-5-12(8-13(11)21)17(18,19)20/h4-5,8,14H,6-7,9-10H2,1-3H3,(H,24,25) |
| InChIKey | SKXLSXSYYGGGGI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.27 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|