C20H32F3N3O — CID 145187473
1-[4-[[2-(diethylamino)-4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]ethanone;ethane (PubChem CID 145187473) has the molecular formula C20H32F3N3O and a molecular weight of 387.49 g/mol. Its IUPAC name is 1-[4-[[2-(diethylamino)-4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]ethanone;ethane.
| Compound Name | 1-[4-[[2-(diethylamino)-4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]ethanone;ethane |
|---|---|
| PubChem CID | 145187473 |
| Molecular Formula | C20H32F3N3O |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | 1-[4-[[2-(diethylamino)-4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]ethanone;ethane |
| SMILES | CC.CCN(CC)c1cc(C(F)(F)F)ccc1CN1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C18H26F3N3O.C2H6/c1-4-23(5-2)17-12-16(18(19,20)21)7-6-15(17)13-22-8-10-24(11-9-22)14(3)25;1-2/h6-7,12H,4-5,8-11,13H2,1-3H3;1-2H3 |
| InChIKey | KRSJPBFIZOOXGS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |