C15H19F4N — CID 138699848
4-fluoro-4-methyl-1-[[2-methyl-4-(trifluoromethyl)phenyl]methyl]piperidine (PubChem CID 138699848) has the molecular formula C15H19F4N and a molecular weight of 289.32 g/mol. Its IUPAC name is 4-fluoro-4-methyl-1-[[2-methyl-4-(trifluoromethyl)phenyl]methyl]piperidine.
| Compound Name | 4-fluoro-4-methyl-1-[[2-methyl-4-(trifluoromethyl)phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 138699848 |
| Molecular Formula | C15H19F4N |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 4-fluoro-4-methyl-1-[[2-methyl-4-(trifluoromethyl)phenyl]methyl]piperidine |
| SMILES | Cc1cc(C(F)(F)F)ccc1CN1CCC(C)(F)CC1 |
| InChI | InChI=1S/C15H19F4N/c1-11-9-13(15(17,18)19)4-3-12(11)10-20-7-5-14(2,16)6-8-20/h3-4,9H,5-8,10H2,1-2H3 |
| InChIKey | MZCTUFRRCVCJGD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |