C18H25F3N2 — CID 120841490
N-(cyclopropylmethyl)-1-[[2-methyl-4-(trifluoromethyl)phenyl]methyl]piperidin-4-amine (PubChem CID 120841490) has the molecular formula C18H25F3N2 and a molecular weight of 326.41 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-1-[[2-methyl-4-(trifluoromethyl)phenyl]methyl]piperidin-4-amine.
| Compound Name | N-(cyclopropylmethyl)-1-[[2-methyl-4-(trifluoromethyl)phenyl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 120841490 |
| Molecular Formula | C18H25F3N2 |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | N-(cyclopropylmethyl)-1-[[2-methyl-4-(trifluoromethyl)phenyl]methyl]piperidin-4-amine |
| SMILES | Cc1cc(C(F)(F)F)ccc1CN1CCC(NCC2CC2)CC1 |
| InChI | InChI=1S/C18H25F3N2/c1-13-10-16(18(19,20)21)5-4-15(13)12-23-8-6-17(7-9-23)22-11-14-2-3-14/h4-5,10,14,17,22H,2-3,6-9,11-12H2,1H3 |
| InChIKey | MSCCPNRZFXRNJO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |