C14H21ClN2S — CID 120841434
1-[(2-chlorothiophen-3-yl)methyl]-N-(cyclopropylmethyl)piperidin-4-amine (PubChem CID 120841434) has the molecular formula C14H21ClN2S and a molecular weight of 284.86 g/mol. Its IUPAC name is 1-[(2-chlorothiophen-3-yl)methyl]-N-(cyclopropylmethyl)piperidin-4-amine.
| Compound Name | 1-[(2-chlorothiophen-3-yl)methyl]-N-(cyclopropylmethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 120841434 |
| Molecular Formula | C14H21ClN2S |
| Molecular Weight | 284.86 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 1-[(2-chlorothiophen-3-yl)methyl]-N-(cyclopropylmethyl)piperidin-4-amine |
| SMILES | Clc1sccc1CN1CCC(NCC2CC2)CC1 |
| InChI | InChI=1S/C14H21ClN2S/c15-14-12(5-8-18-14)10-17-6-3-13(4-7-17)16-9-11-1-2-11/h5,8,11,13,16H,1-4,6-7,9-10H2 |
| InChIKey | WCLMLJIAQPGNEV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.86 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |