C15H21Cl2N3 — CID 106994959
N-(cyclopropylmethyl)-1-[(2,6-dichloro-3-pyridinyl)methyl]piperidin-4-amine (PubChem CID 106994959) has the molecular formula C15H21Cl2N3 and a molecular weight of 314.26 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-1-[(2,6-dichloro-3-pyridinyl)methyl]piperidin-4-amine.
| Compound Name | N-(cyclopropylmethyl)-1-[(2,6-dichloro-3-pyridinyl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 106994959 |
| Molecular Formula | C15H21Cl2N3 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | N-(cyclopropylmethyl)-1-[(2,6-dichloro-3-pyridinyl)methyl]piperidin-4-amine |
| SMILES | Clc1ccc(CN2CCC(NCC3CC3)CC2)c(Cl)n1 |
| InChI | InChI=1S/C15H21Cl2N3/c16-14-4-3-12(15(17)19-14)10-20-7-5-13(6-8-20)18-9-11-1-2-11/h3-4,11,13,18H,1-2,5-10H2 |
| InChIKey | FRSHFPSSMZKMJD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|