C12H15Cl2N3O — CID 104969517
1-[(2,6-dichloro-3-pyridinyl)methyl]piperidine-4-carboxamide (PubChem CID 104969517) has the molecular formula C12H15Cl2N3O and a molecular weight of 288.18 g/mol. Its IUPAC name is 1-[(2,6-dichloro-3-pyridinyl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-[(2,6-dichloro-3-pyridinyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 104969517 |
| Molecular Formula | C12H15Cl2N3O |
| Molecular Weight | 288.18 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 1-[(2,6-dichloro-3-pyridinyl)methyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(Cc2ccc(Cl)nc2Cl)CC1 |
| InChI | InChI=1S/C12H15Cl2N3O/c13-10-2-1-9(11(14)16-10)7-17-5-3-8(4-6-17)12(15)18/h1-2,8H,3-7H2,(H2,15,18) |
| InChIKey | UGOOPTITRFLAJV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.18 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|