C12H13Cl2F3N2 — CID 106993824
2,6-dichloro-3-[[4-(trifluoromethyl)piperidin-1-yl]methyl]pyridine (PubChem CID 106993824) has the molecular formula C12H13Cl2F3N2 and a molecular weight of 313.15 g/mol. Its IUPAC name is 2,6-dichloro-3-[[4-(trifluoromethyl)piperidin-1-yl]methyl]pyridine.
| Compound Name | 2,6-dichloro-3-[[4-(trifluoromethyl)piperidin-1-yl]methyl]pyridine |
|---|---|
| PubChem CID | 106993824 |
| Molecular Formula | C12H13Cl2F3N2 |
| Molecular Weight | 313.15 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 2,6-dichloro-3-[[4-(trifluoromethyl)piperidin-1-yl]methyl]pyridine |
| SMILES | FC(F)(F)C1CCN(Cc2ccc(Cl)nc2Cl)CC1 |
| InChI | InChI=1S/C12H13Cl2F3N2/c13-10-2-1-8(11(14)18-10)7-19-5-3-9(4-6-19)12(15,16)17/h1-2,9H,3-7H2 |
| InChIKey | UYBKJAMREQDQGC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.15 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|