C16H24F3NSi — CID 103438463
trimethyl-[4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]phenyl]silane (PubChem CID 103438463) has the molecular formula C16H24F3NSi and a molecular weight of 315.46 g/mol. Its IUPAC name is trimethyl-[4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]phenyl]silane.
| Compound Name | trimethyl-[4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]phenyl]silane |
|---|---|
| PubChem CID | 103438463 |
| Molecular Formula | C16H24F3NSi |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | trimethyl-[4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]phenyl]silane |
| SMILES | C[Si](C)(C)c1ccc(CN2CCC(C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C16H24F3NSi/c1-21(2,3)15-6-4-13(5-7-15)12-20-10-8-14(9-11-20)16(17,18)19/h4-7,14H,8-12H2,1-3H3 |
| InChIKey | MMODOLQWWVZOBG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|