C16H24N2Si — CID 100718936
1-[(4-trimethylsilylphenyl)methyl]piperidine-4-carbonitrile (PubChem CID 100718936) has the molecular formula C16H24N2Si and a molecular weight of 272.47 g/mol. Its IUPAC name is 1-[(4-trimethylsilylphenyl)methyl]piperidine-4-carbonitrile.
| Compound Name | 1-[(4-trimethylsilylphenyl)methyl]piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 100718936 |
| Molecular Formula | C16H24N2Si |
| Molecular Weight | 272.47 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 1-[(4-trimethylsilylphenyl)methyl]piperidine-4-carbonitrile |
| SMILES | C[Si](C)(C)c1ccc(CN2CCC(C#N)CC2)cc1 |
| InChI | InChI=1S/C16H24N2Si/c1-19(2,3)16-6-4-15(5-7-16)13-18-10-8-14(12-17)9-11-18/h4-7,14H,8-11,13H2,1-3H3 |
| InChIKey | HRMCDDQEJMNHKW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|