C17H29N3Si — CID 103438191
[4-[[4-(azetidin-3-yl)piperazin-1-yl]methyl]phenyl]-trimethylsilane (PubChem CID 103438191) has the molecular formula C17H29N3Si and a molecular weight of 303.53 g/mol. Its IUPAC name is [4-[[4-(azetidin-3-yl)piperazin-1-yl]methyl]phenyl]-trimethylsilane.
| Compound Name | [4-[[4-(azetidin-3-yl)piperazin-1-yl]methyl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 103438191 |
| Molecular Formula | C17H29N3Si |
| Molecular Weight | 303.53 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | [4-[[4-(azetidin-3-yl)piperazin-1-yl]methyl]phenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc(CN2CCN(C3CNC3)CC2)cc1 |
| InChI | InChI=1S/C17H29N3Si/c1-21(2,3)17-6-4-15(5-7-17)14-19-8-10-20(11-9-19)16-12-18-13-16/h4-7,16,18H,8-14H2,1-3H3 |
| InChIKey | KAQQNBRBXGGWHE-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.53 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|