C14H19Cl2N3 — CID 66202514
1-(azetidin-3-yl)-4-[(2,6-dichlorophenyl)methyl]piperazine (PubChem CID 66202514) has the molecular formula C14H19Cl2N3 and a molecular weight of 300.23 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-4-[(2,6-dichlorophenyl)methyl]piperazine.
| Compound Name | 1-(azetidin-3-yl)-4-[(2,6-dichlorophenyl)methyl]piperazine |
|---|---|
| PubChem CID | 66202514 |
| Molecular Formula | C14H19Cl2N3 |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 1-(azetidin-3-yl)-4-[(2,6-dichlorophenyl)methyl]piperazine |
| SMILES | Clc1cccc(Cl)c1CN1CCN(C2CNC2)CC1 |
| InChI | InChI=1S/C14H19Cl2N3/c15-13-2-1-3-14(16)12(13)10-18-4-6-19(7-5-18)11-8-17-9-11/h1-3,11,17H,4-10H2 |
| InChIKey | CLNFGLMDBGVELA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |