C17H17Cl2FN2 — CID 782911
1-[(2,6-dichlorophenyl)methyl]-4-(4-fluorophenyl)piperazine (PubChem CID 782911) has the molecular formula C17H17Cl2FN2 and a molecular weight of 339.24 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methyl]-4-(4-fluorophenyl)piperazine.
| Compound Name | 1-[(2,6-dichlorophenyl)methyl]-4-(4-fluorophenyl)piperazine |
|---|---|
| PubChem CID | 782911 |
| Molecular Formula | C17H17Cl2FN2 |
| Molecular Weight | 339.24 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methyl]-4-(4-fluorophenyl)piperazine |
| SMILES | Fc1ccc(N2CCN(Cc3c(Cl)cccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C17H17Cl2FN2/c18-16-2-1-3-17(19)15(16)12-21-8-10-22(11-9-21)14-6-4-13(20)5-7-14/h1-7H,8-12H2 |
| InChIKey | XRLIGBOWQIKRRA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.24 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |