C16H28N2Si — CID 103438168
[4-[(2,6-dimethylpiperazin-1-yl)methyl]phenyl]-trimethylsilane (PubChem CID 103438168) has the molecular formula C16H28N2Si and a molecular weight of 276.50 g/mol. Its IUPAC name is [4-[(2,6-dimethylpiperazin-1-yl)methyl]phenyl]-trimethylsilane.
| Compound Name | [4-[(2,6-dimethylpiperazin-1-yl)methyl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 103438168 |
| Molecular Formula | C16H28N2Si |
| Molecular Weight | 276.50 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | [4-[(2,6-dimethylpiperazin-1-yl)methyl]phenyl]-trimethylsilane |
| SMILES | CC1CNCC(C)N1Cc1ccc([Si](C)(C)C)cc1 |
| InChI | InChI=1S/C16H28N2Si/c1-13-10-17-11-14(2)18(13)12-15-6-8-16(9-7-15)19(3,4)5/h6-9,13-14,17H,10-12H2,1-5H3 |
| InChIKey | MEGJLFSIUDTJGW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.50 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|