C17H29NSi — CID 103438410
[4-[(2,4-dimethylpiperidin-1-yl)methyl]phenyl]-trimethylsilane (PubChem CID 103438410) has the molecular formula C17H29NSi and a molecular weight of 275.51 g/mol. Its IUPAC name is [4-[(2,4-dimethylpiperidin-1-yl)methyl]phenyl]-trimethylsilane.
| Compound Name | [4-[(2,4-dimethylpiperidin-1-yl)methyl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 103438410 |
| Molecular Formula | C17H29NSi |
| Molecular Weight | 275.51 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | [4-[(2,4-dimethylpiperidin-1-yl)methyl]phenyl]-trimethylsilane |
| SMILES | CC1CCN(Cc2ccc([Si](C)(C)C)cc2)C(C)C1 |
| InChI | InChI=1S/C17H29NSi/c1-14-10-11-18(15(2)12-14)13-16-6-8-17(9-7-16)19(3,4)5/h6-9,14-15H,10-13H2,1-5H3 |
| InChIKey | IEWXFGBDZSWSQF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|