C17H30N2OSi — CID 103438223
[4-methoxy-1-[(4-trimethylsilylphenyl)methyl]piperidin-2-yl]methanamine (PubChem CID 103438223) has the molecular formula C17H30N2OSi and a molecular weight of 306.53 g/mol. Its IUPAC name is [4-methoxy-1-[(4-trimethylsilylphenyl)methyl]piperidin-2-yl]methanamine.
| Compound Name | [4-methoxy-1-[(4-trimethylsilylphenyl)methyl]piperidin-2-yl]methanamine |
|---|---|
| PubChem CID | 103438223 |
| Molecular Formula | C17H30N2OSi |
| Molecular Weight | 306.53 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | [4-methoxy-1-[(4-trimethylsilylphenyl)methyl]piperidin-2-yl]methanamine |
| SMILES | COC1CCN(Cc2ccc([Si](C)(C)C)cc2)C(CN)C1 |
| InChI | InChI=1S/C17H30N2OSi/c1-20-16-9-10-19(15(11-16)12-18)13-14-5-7-17(8-6-14)21(2,3)4/h5-8,15-16H,9-13,18H2,1-4H3 |
| InChIKey | DLXHTWLDBMPFDX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.53 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|