C13H20ClN3O — CID 112622776
[1-[(3-chloro-4-pyridinyl)methyl]-4-methoxypiperidin-2-yl]methanamine (PubChem CID 112622776) has the molecular formula C13H20ClN3O and a molecular weight of 269.78 g/mol. Its IUPAC name is [1-[(3-chloro-4-pyridinyl)methyl]-4-methoxypiperidin-2-yl]methanamine.
| Compound Name | [1-[(3-chloro-4-pyridinyl)methyl]-4-methoxypiperidin-2-yl]methanamine |
|---|---|
| PubChem CID | 112622776 |
| Molecular Formula | C13H20ClN3O |
| Molecular Weight | 269.78 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | [1-[(3-chloro-4-pyridinyl)methyl]-4-methoxypiperidin-2-yl]methanamine |
| SMILES | COC1CCN(Cc2ccncc2Cl)C(CN)C1 |
| InChI | InChI=1S/C13H20ClN3O/c1-18-12-3-5-17(11(6-12)7-15)9-10-2-4-16-8-13(10)14/h2,4,8,11-12H,3,5-7,9,15H2,1H3 |
| InChIKey | VFKYBTCUSOKSFA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.78 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |