C14H20ClN3O3 — CID 115963817
[1-[(4-chloro-2-nitrophenyl)methyl]-4-methoxypiperidin-2-yl]methanamine (PubChem CID 115963817) has the molecular formula C14H20ClN3O3 and a molecular weight of 313.79 g/mol. Its IUPAC name is [1-[(4-chloro-2-nitrophenyl)methyl]-4-methoxypiperidin-2-yl]methanamine.
| Compound Name | [1-[(4-chloro-2-nitrophenyl)methyl]-4-methoxypiperidin-2-yl]methanamine |
|---|---|
| PubChem CID | 115963817 |
| Molecular Formula | C14H20ClN3O3 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | [1-[(4-chloro-2-nitrophenyl)methyl]-4-methoxypiperidin-2-yl]methanamine |
| SMILES | COC1CCN(Cc2ccc(Cl)cc2[N+](=O)[O-])C(CN)C1 |
| InChI | InChI=1S/C14H20ClN3O3/c1-21-13-4-5-17(12(7-13)8-16)9-10-2-3-11(15)6-14(10)18(19)20/h2-3,6,12-13H,4-5,7-9,16H2,1H3 |
| InChIKey | YHXHIXMINMZKJY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|