C14H20N2O — CID 126758266
3-[[(2S,6R)-2,6-dimethylpiperazin-1-yl]methyl]benzaldehyde (PubChem CID 126758266) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 3-[[(2S,6R)-2,6-dimethylpiperazin-1-yl]methyl]benzaldehyde.
| Compound Name | 3-[[(2S,6R)-2,6-dimethylpiperazin-1-yl]methyl]benzaldehyde |
|---|---|
| PubChem CID | 126758266 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 3-[[(2S,6R)-2,6-dimethylpiperazin-1-yl]methyl]benzaldehyde |
| SMILES | C[C@@H]1CNC[C@H](C)N1Cc1cccc(C=O)c1 |
| InChI | InChI=1S/C14H20N2O/c1-11-7-15-8-12(2)16(11)9-13-4-3-5-14(6-13)10-17/h3-6,10-12,15H,7-9H2,1-2H3/t11-,12+ |
| InChIKey | FXLWAMNYKWUAEQ-TXEJJXNPSA-N |
| XLogP | 1.68 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|