C13H18FN — CID 146164632
1-[(3-fluorophenyl)methyl]-2,5-dimethylpyrrolidine (PubChem CID 146164632) has the molecular formula C13H18FN and a molecular weight of 207.29 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-2,5-dimethylpyrrolidine.
| Compound Name | 1-[(3-fluorophenyl)methyl]-2,5-dimethylpyrrolidine |
|---|---|
| PubChem CID | 146164632 |
| Molecular Formula | C13H18FN |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-2,5-dimethylpyrrolidine |
| SMILES | CC1CCC(C)N1Cc1cccc(F)c1 |
| InChI | InChI=1S/C13H18FN/c1-10-6-7-11(2)15(10)9-12-4-3-5-13(14)8-12/h3-5,8,10-11H,6-7,9H2,1-2H3 |
| InChIKey | BKPCPVWDUBNEGQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |