C11H17BrN2S — CID 63910635
1-[(5-bromothiophen-3-yl)methyl]-2,6-dimethylpiperazine (PubChem CID 63910635) has the molecular formula C11H17BrN2S and a molecular weight of 289.24 g/mol. Its IUPAC name is 1-[(5-bromothiophen-3-yl)methyl]-2,6-dimethylpiperazine.
| Compound Name | 1-[(5-bromothiophen-3-yl)methyl]-2,6-dimethylpiperazine |
|---|---|
| PubChem CID | 63910635 |
| Molecular Formula | C11H17BrN2S |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 1-[(5-bromothiophen-3-yl)methyl]-2,6-dimethylpiperazine |
| SMILES | CC1CNCC(C)N1Cc1csc(Br)c1 |
| InChI | InChI=1S/C11H17BrN2S/c1-8-4-13-5-9(2)14(8)6-10-3-11(12)15-7-10/h3,7-9,13H,4-6H2,1-2H3 |
| InChIKey | QAXBEWGQAIUNKQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |