About 1-[(5-bromothiophen-3-yl)methyl]-2,5-diethylpiperazine
1-[(5-bromothiophen-3-yl)methyl]-2,5-diethylpiperazine (PubChem CID 64978692) has the molecular formula C13H21BrN2S
and a molecular weight of 317.30 g/mol. Its IUPAC name is 1-[(5-bromothiophen-3-yl)methyl]-2,5-diethylpiperazine.
Molecular Properties
| Compound Name | 1-[(5-bromothiophen-3-yl)methyl]-2,5-diethylpiperazine |
| PubChem CID | 64978692 |
| Molecular Formula | C13H21BrN2S |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 1-[(5-bromothiophen-3-yl)methyl]-2,5-diethylpiperazine |
| SMILES | CCC1CN(Cc2csc(Br)c2)C(CC)CN1 |
| InChI | InChI=1S/C13H21BrN2S/c1-3-11-8-16(12(4-2)6-15-11)7-10-5-13(14)17-9-10/h5,9,11-12,15H,3-4,6-8H2,1-2H3 |
| InChIKey | OMFYSWCCSYJGBD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(5-bromothiophen-3-yl)methyl]-2,5-diethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-bromothiophen-3-yl)methyl]-2,5-diethylpiperazine?
The IUPAC name of 1-[(5-bromothiophen-3-yl)methyl]-2,5-diethylpiperazine (CID 64978692) is 1-[(5-bromothiophen-3-yl)methyl]-2,5-diethylpiperazine.
What is the SMILES notation for 1-[(5-bromothiophen-3-yl)methyl]-2,5-diethylpiperazine?
The canonical SMILES for 1-[(5-bromothiophen-3-yl)methyl]-2,5-diethylpiperazine is CCC1CN(Cc2csc(Br)c2)C(CC)CN1.
What is the InChIKey of 1-[(5-bromothiophen-3-yl)methyl]-2,5-diethylpiperazine?
The InChIKey is OMFYSWCCSYJGBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21BrN2S/c1-3-11-8-16(12(4-2)6-15-11)7-10-5-13(14)17-9-10/h5,9,11-12,15H,3-4,6-8H2,1-2H3.
What are the key properties of 1-[(5-bromothiophen-3-yl)methyl]-2,5-diethylpiperazine?
1-[(5-bromothiophen-3-yl)methyl]-2,5-diethylpiperazine has a molecular weight of 317.30 g/mol, XLogP of 3.47, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-bromothiophen-3-yl)methyl]-2,5-diethylpiperazine is sourced from PubChem (CID 64978692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).