About 2-[(2,5-diethylpiperazin-1-yl)methyl]-1,3-thiazole
2-[(2,5-diethylpiperazin-1-yl)methyl]-1,3-thiazole (PubChem CID 64946674) has the molecular formula C12H21N3S
and a molecular weight of 239.39 g/mol. Its IUPAC name is 2-[(2,5-diethylpiperazin-1-yl)methyl]-1,3-thiazole.
Molecular Properties
| Compound Name | 2-[(2,5-diethylpiperazin-1-yl)methyl]-1,3-thiazole |
| PubChem CID | 64946674 |
| Molecular Formula | C12H21N3S |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 2-[(2,5-diethylpiperazin-1-yl)methyl]-1,3-thiazole |
| SMILES | CCC1CN(Cc2nccs2)C(CC)CN1 |
| InChI | InChI=1S/C12H21N3S/c1-3-10-8-15(11(4-2)7-14-10)9-12-13-5-6-16-12/h5-6,10-11,14H,3-4,7-9H2,1-2H3 |
| InChIKey | SYNRVLNLNJRXID-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2,5-diethylpiperazin-1-yl)methyl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,5-diethylpiperazin-1-yl)methyl]-1,3-thiazole?
The IUPAC name of 2-[(2,5-diethylpiperazin-1-yl)methyl]-1,3-thiazole (CID 64946674) is 2-[(2,5-diethylpiperazin-1-yl)methyl]-1,3-thiazole.
What is the SMILES notation for 2-[(2,5-diethylpiperazin-1-yl)methyl]-1,3-thiazole?
The canonical SMILES for 2-[(2,5-diethylpiperazin-1-yl)methyl]-1,3-thiazole is CCC1CN(Cc2nccs2)C(CC)CN1.
What is the InChIKey of 2-[(2,5-diethylpiperazin-1-yl)methyl]-1,3-thiazole?
The InChIKey is SYNRVLNLNJRXID-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3S/c1-3-10-8-15(11(4-2)7-14-10)9-12-13-5-6-16-12/h5-6,10-11,14H,3-4,7-9H2,1-2H3.
What are the key properties of 2-[(2,5-diethylpiperazin-1-yl)methyl]-1,3-thiazole?
2-[(2,5-diethylpiperazin-1-yl)methyl]-1,3-thiazole has a molecular weight of 239.39 g/mol, XLogP of 2.11, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,5-diethylpiperazin-1-yl)methyl]-1,3-thiazole is sourced from PubChem (CID 64946674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).