C16H23ClN2O2 — CID 64978599
1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-2,5-diethylpiperazine (PubChem CID 64978599) has the molecular formula C16H23ClN2O2 and a molecular weight of 310.83 g/mol. Its IUPAC name is 1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-2,5-diethylpiperazine.
| Compound Name | 1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-2,5-diethylpiperazine |
|---|---|
| PubChem CID | 64978599 |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]-2,5-diethylpiperazine |
| SMILES | CCC1CN(Cc2cc(Cl)c3c(c2)OCO3)C(CC)CN1 |
| InChI | InChI=1S/C16H23ClN2O2/c1-3-12-9-19(13(4-2)7-18-12)8-11-5-14(17)16-15(6-11)20-10-21-16/h5-6,12-13,18H,3-4,7-10H2,1-2H3 |
| InChIKey | MQDPKAFOHFIOBR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |