About 1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]piperidine-2-carbaldehyde
1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]piperidine-2-carbaldehyde (PubChem CID 62656619) has the molecular formula C14H16ClNO3
and a molecular weight of 281.74 g/mol. Its IUPAC name is 1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]piperidine-2-carbaldehyde.
Molecular Properties
| Compound Name | 1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]piperidine-2-carbaldehyde |
| PubChem CID | 62656619 |
| Molecular Formula | C14H16ClNO3 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]piperidine-2-carbaldehyde |
| SMILES | O=CC1CCCCN1Cc1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C14H16ClNO3/c15-12-5-10(6-13-14(12)19-9-18-13)7-16-4-2-1-3-11(16)8-17/h5-6,8,11H,1-4,7,9H2 |
| InChIKey | XIZULCDRPVMUCC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]piperidine-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]piperidine-2-carbaldehyde?
The IUPAC name of 1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]piperidine-2-carbaldehyde (CID 62656619) is 1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]piperidine-2-carbaldehyde.
What is the SMILES notation for 1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]piperidine-2-carbaldehyde?
The canonical SMILES for 1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]piperidine-2-carbaldehyde is O=CC1CCCCN1Cc1cc(Cl)c2c(c1)OCO2.
What is the InChIKey of 1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]piperidine-2-carbaldehyde?
The InChIKey is XIZULCDRPVMUCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClNO3/c15-12-5-10(6-13-14(12)19-9-18-13)7-16-4-2-1-3-11(16)8-17/h5-6,8,11H,1-4,7,9H2.
What are the key properties of 1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]piperidine-2-carbaldehyde?
1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]piperidine-2-carbaldehyde has a molecular weight of 281.74 g/mol, XLogP of 2.62, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(7-chloro-1,3-benzodioxol-5-yl)methyl]piperidine-2-carbaldehyde is sourced from PubChem (CID 62656619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).