C15H21Cl2N3 — CID 106993757
2,6-dichloro-3-[(3-piperidin-1-ylpyrrolidin-1-yl)methyl]pyridine (PubChem CID 106993757) has the molecular formula C15H21Cl2N3 and a molecular weight of 314.26 g/mol. Its IUPAC name is 2,6-dichloro-3-[(3-piperidin-1-ylpyrrolidin-1-yl)methyl]pyridine.
| Compound Name | 2,6-dichloro-3-[(3-piperidin-1-ylpyrrolidin-1-yl)methyl]pyridine |
|---|---|
| PubChem CID | 106993757 |
| Molecular Formula | C15H21Cl2N3 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 2,6-dichloro-3-[(3-piperidin-1-ylpyrrolidin-1-yl)methyl]pyridine |
| SMILES | Clc1ccc(CN2CCC(N3CCCCC3)C2)c(Cl)n1 |
| InChI | InChI=1S/C15H21Cl2N3/c16-14-5-4-12(15(17)18-14)10-19-9-6-13(11-19)20-7-2-1-3-8-20/h4-5,13H,1-3,6-11H2 |
| InChIKey | LIMHTZGVDWTVCZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|