C14H19Cl2N3 — CID 116518981
2,4-dichloro-5-[(3-pyrrolidin-1-ylpyrrolidin-1-yl)methyl]pyridine (PubChem CID 116518981) has the molecular formula C14H19Cl2N3 and a molecular weight of 300.23 g/mol. Its IUPAC name is 2,4-dichloro-5-[(3-pyrrolidin-1-ylpyrrolidin-1-yl)methyl]pyridine.
| Compound Name | 2,4-dichloro-5-[(3-pyrrolidin-1-ylpyrrolidin-1-yl)methyl]pyridine |
|---|---|
| PubChem CID | 116518981 |
| Molecular Formula | C14H19Cl2N3 |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 2,4-dichloro-5-[(3-pyrrolidin-1-ylpyrrolidin-1-yl)methyl]pyridine |
| SMILES | Clc1cc(Cl)c(CN2CCC(N3CCCC3)C2)cn1 |
| InChI | InChI=1S/C14H19Cl2N3/c15-13-7-14(16)17-8-11(13)9-18-6-3-12(10-18)19-4-1-2-5-19/h7-8,12H,1-6,9-10H2 |
| InChIKey | XKFCTAXRRYQSIX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|