C12H17Cl2N3 — CID 116519780
[1-[(4,6-dichloro-3-pyridinyl)methyl]piperidin-3-yl]methanamine (PubChem CID 116519780) has the molecular formula C12H17Cl2N3 and a molecular weight of 274.19 g/mol. Its IUPAC name is [1-[(4,6-dichloro-3-pyridinyl)methyl]piperidin-3-yl]methanamine.
| Compound Name | [1-[(4,6-dichloro-3-pyridinyl)methyl]piperidin-3-yl]methanamine |
|---|---|
| PubChem CID | 116519780 |
| Molecular Formula | C12H17Cl2N3 |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | [1-[(4,6-dichloro-3-pyridinyl)methyl]piperidin-3-yl]methanamine |
| SMILES | NCC1CCCN(Cc2cnc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C12H17Cl2N3/c13-11-4-12(14)16-6-10(11)8-17-3-1-2-9(5-15)7-17/h4,6,9H,1-3,5,7-8,15H2 |
| InChIKey | ODJXGIZUQVPISR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|