C13H17Cl2N3 — CID 116519047
2-[(4,6-dichloro-3-pyridinyl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 116519047) has the molecular formula C13H17Cl2N3 and a molecular weight of 286.21 g/mol. Its IUPAC name is 2-[(4,6-dichloro-3-pyridinyl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | 2-[(4,6-dichloro-3-pyridinyl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 116519047 |
| Molecular Formula | C13H17Cl2N3 |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2-[(4,6-dichloro-3-pyridinyl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | Clc1cc(Cl)c(CN2CCN3CCCC3C2)cn1 |
| InChI | InChI=1S/C13H17Cl2N3/c14-12-6-13(15)16-7-10(12)8-17-4-5-18-3-1-2-11(18)9-17/h6-7,11H,1-5,8-9H2 |
| InChIKey | MQBAAQLBNVJZHW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|