C13H17Cl2N3O — CID 106993660
1-[4-[(2,6-dichloro-3-pyridinyl)methyl]-1,4-diazepan-1-yl]ethanone (PubChem CID 106993660) has the molecular formula C13H17Cl2N3O and a molecular weight of 302.20 g/mol. Its IUPAC name is 1-[4-[(2,6-dichloro-3-pyridinyl)methyl]-1,4-diazepan-1-yl]ethanone.
| Compound Name | 1-[4-[(2,6-dichloro-3-pyridinyl)methyl]-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 106993660 |
| Molecular Formula | C13H17Cl2N3O |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 1-[4-[(2,6-dichloro-3-pyridinyl)methyl]-1,4-diazepan-1-yl]ethanone |
| SMILES | CC(=O)N1CCCN(Cc2ccc(Cl)nc2Cl)CC1 |
| InChI | InChI=1S/C13H17Cl2N3O/c1-10(19)18-6-2-5-17(7-8-18)9-11-3-4-12(14)16-13(11)15/h3-4H,2,5-9H2,1H3 |
| InChIKey | LGWVYNVLINWEFQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|