C11H13Cl2N3O — CID 106993818
4-[(2,6-dichloro-3-pyridinyl)methyl]-1,4-diazepan-2-one (PubChem CID 106993818) has the molecular formula C11H13Cl2N3O and a molecular weight of 274.15 g/mol. Its IUPAC name is 4-[(2,6-dichloro-3-pyridinyl)methyl]-1,4-diazepan-2-one.
| Compound Name | 4-[(2,6-dichloro-3-pyridinyl)methyl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 106993818 |
| Molecular Formula | C11H13Cl2N3O |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 4-[(2,6-dichloro-3-pyridinyl)methyl]-1,4-diazepan-2-one |
| SMILES | O=C1CN(Cc2ccc(Cl)nc2Cl)CCCN1 |
| InChI | InChI=1S/C11H13Cl2N3O/c12-9-3-2-8(11(13)15-9)6-16-5-1-4-14-10(17)7-16/h2-3H,1,4-7H2,(H,14,17) |
| InChIKey | SHHIXTRAKRFQGH-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|