C15H18N2O3 — CID 77066548
3-[4-[(3-oxo-1,4-diazepan-1-yl)methyl]phenyl]prop-2-enoic acid (PubChem CID 77066548) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 3-[4-[(3-oxo-1,4-diazepan-1-yl)methyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[(3-oxo-1,4-diazepan-1-yl)methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77066548 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 3-[4-[(3-oxo-1,4-diazepan-1-yl)methyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(CN2CCCNC(=O)C2)cc1 |
| InChI | InChI=1S/C15H18N2O3/c18-14-11-17(9-1-8-16-14)10-13-4-2-12(3-5-13)6-7-15(19)20/h2-7H,1,8-11H2,(H,16,18)(H,19,20) |
| InChIKey | YMCPXRQMXGMUFG-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|