C17H21NO2 — CID 115561317
(E)-3-[4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)phenyl]prop-2-enoic acid (PubChem CID 115561317) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is (E)-3-[4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 115561317 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | (E)-3-[4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(CN2CC3CCCC3C2)cc1 |
| InChI | InChI=1S/C17H21NO2/c19-17(20)9-8-13-4-6-14(7-5-13)10-18-11-15-2-1-3-16(15)12-18/h4-9,15-16H,1-3,10-12H2,(H,19,20)/b9-8+ |
| InChIKey | YDBBWCNEXKNSMG-CMDGGOBGSA-N |
| XLogP | 3.02 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|