C12H14N4O3 — CID 113388433
(E)-3-[2-(3-oxo-1,4-diazepan-1-yl)pyrimidin-5-yl]prop-2-enoic acid (PubChem CID 113388433) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is (E)-3-[2-(3-oxo-1,4-diazepan-1-yl)pyrimidin-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(3-oxo-1,4-diazepan-1-yl)pyrimidin-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 113388433 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | (E)-3-[2-(3-oxo-1,4-diazepan-1-yl)pyrimidin-5-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cnc(N2CCCNC(=O)C2)nc1 |
| InChI | InChI=1S/C12H14N4O3/c17-10-8-16(5-1-4-13-10)12-14-6-9(7-15-12)2-3-11(18)19/h2-3,6-7H,1,4-5,8H2,(H,13,17)(H,18,19)/b3-2+ |
| InChIKey | IRTCHOPHWWRVJG-NSCUHMNNSA-N |
| XLogP | -0.10 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|