C8H10N4O2 — CID 170608723
4-(5-hydroxypyrimidin-2-yl)piperazin-2-one (PubChem CID 170608723) has the molecular formula C8H10N4O2 and a molecular weight of 194.19 g/mol. Its IUPAC name is 4-(5-hydroxypyrimidin-2-yl)piperazin-2-one.
| Compound Name | 4-(5-hydroxypyrimidin-2-yl)piperazin-2-one |
|---|---|
| PubChem CID | 170608723 |
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 4-(5-hydroxypyrimidin-2-yl)piperazin-2-one |
| SMILES | O=C1CN(c2ncc(O)cn2)CCN1 |
| InChI | InChI=1S/C8H10N4O2/c13-6-3-10-8(11-4-6)12-2-1-9-7(14)5-12/h3-4,13H,1-2,5H2,(H,9,14) |
| InChIKey | MKDOCLZVYLKADQ-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |