About 4-(1,2,4-thiadiazol-5-yl)piperazin-2-one
4-(1,2,4-thiadiazol-5-yl)piperazin-2-one (PubChem CID 130692977) has the molecular formula C6H8N4OS
and a molecular weight of 184.22 g/mol. Its IUPAC name is 4-(1,2,4-thiadiazol-5-yl)piperazin-2-one.
Molecular Properties
| Compound Name | 4-(1,2,4-thiadiazol-5-yl)piperazin-2-one |
| PubChem CID | 130692977 |
| Molecular Formula | C6H8N4OS |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | 4-(1,2,4-thiadiazol-5-yl)piperazin-2-one |
| SMILES | O=C1CN(c2ncns2)CCN1 |
| InChI | InChI=1S/C6H8N4OS/c11-5-3-10(2-1-7-5)6-8-4-9-12-6/h4H,1-3H2,(H,7,11) |
| InChIKey | QOAASDTYRPWIDW-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1,2,4-thiadiazol-5-yl)piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,2,4-thiadiazol-5-yl)piperazin-2-one?
The IUPAC name of 4-(1,2,4-thiadiazol-5-yl)piperazin-2-one (CID 130692977) is 4-(1,2,4-thiadiazol-5-yl)piperazin-2-one.
What is the SMILES notation for 4-(1,2,4-thiadiazol-5-yl)piperazin-2-one?
The canonical SMILES for 4-(1,2,4-thiadiazol-5-yl)piperazin-2-one is O=C1CN(c2ncns2)CCN1.
What is the InChIKey of 4-(1,2,4-thiadiazol-5-yl)piperazin-2-one?
The InChIKey is QOAASDTYRPWIDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4OS/c11-5-3-10(2-1-7-5)6-8-4-9-12-6/h4H,1-3H2,(H,7,11).
What are the key properties of 4-(1,2,4-thiadiazol-5-yl)piperazin-2-one?
4-(1,2,4-thiadiazol-5-yl)piperazin-2-one has a molecular weight of 184.22 g/mol, XLogP of -0.53, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,2,4-thiadiazol-5-yl)piperazin-2-one is sourced from PubChem (CID 130692977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).