C10H16N4OS — CID 136532398
4-[3-(2-methylpropyl)-1,2,4-thiadiazol-5-yl]piperazin-2-one (PubChem CID 136532398) has the molecular formula C10H16N4OS and a molecular weight of 240.33 g/mol. Its IUPAC name is 4-[3-(2-methylpropyl)-1,2,4-thiadiazol-5-yl]piperazin-2-one.
| Compound Name | 4-[3-(2-methylpropyl)-1,2,4-thiadiazol-5-yl]piperazin-2-one |
|---|---|
| PubChem CID | 136532398 |
| Molecular Formula | C10H16N4OS |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 4-[3-(2-methylpropyl)-1,2,4-thiadiazol-5-yl]piperazin-2-one |
| SMILES | CC(C)Cc1nsc(N2CCNC(=O)C2)n1 |
| InChI | InChI=1S/C10H16N4OS/c1-7(2)5-8-12-10(16-13-8)14-4-3-11-9(15)6-14/h7H,3-6H2,1-2H3,(H,11,15) |
| InChIKey | FBBQMMFLXVYKAH-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |